C28H22FN3O3 — CID 41200793
(2R)-1,3-dibenzyl-2-(2-fluorophenyl)-6-nitro-2H-quinazolin-4-one (PubChem CID 41200793) has the molecular formula C28H22FN3O3 and a molecular weight of 467.50 g/mol. Its IUPAC name is (2R)-1,3-dibenzyl-2-(2-fluorophenyl)-6-nitro-2H-quinazolin-4-one.
| Compound Name | (2R)-1,3-dibenzyl-2-(2-fluorophenyl)-6-nitro-2H-quinazolin-4-one |
|---|---|
| PubChem CID | 41200793 |
| Molecular Formula | C28H22FN3O3 |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | (2R)-1,3-dibenzyl-2-(2-fluorophenyl)-6-nitro-2H-quinazolin-4-one |
| SMILES | O=C1c2cc([N+](=O)[O-])ccc2N(Cc2ccccc2)[C@@H](c2ccccc2F)N1Cc1ccccc1 |
| InChI | InChI=1S/C28H22FN3O3/c29-25-14-8-7-13-23(25)27-30(18-20-9-3-1-4-10-20)26-16-15-22(32(34)35)17-24(26)28(33)31(27)19-21-11-5-2-6-12-21/h1-17,27H,18-19H2/t27-/m1/s1 |
| InChIKey | JUMWUIIJPQKXEK-HHHXNRCGSA-N |
| XLogP | 6.10 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|