C31H29N3O6 — CID 94854737
(2S)-1,3-dibenzyl-6-nitro-2-(3,4,5-trimethoxyphenyl)-2H-quinazolin-4-one (PubChem CID 94854737) has the molecular formula C31H29N3O6 and a molecular weight of 539.59 g/mol. Its IUPAC name is (2S)-1,3-dibenzyl-6-nitro-2-(3,4,5-trimethoxyphenyl)-2H-quinazolin-4-one.
| Compound Name | (2S)-1,3-dibenzyl-6-nitro-2-(3,4,5-trimethoxyphenyl)-2H-quinazolin-4-one |
|---|---|
| PubChem CID | 94854737 |
| Molecular Formula | C31H29N3O6 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | (2S)-1,3-dibenzyl-6-nitro-2-(3,4,5-trimethoxyphenyl)-2H-quinazolin-4-one |
| SMILES | COc1cc([C@@H]2N(Cc3ccccc3)C(=O)c3cc([N+](=O)[O-])ccc3N2Cc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C31H29N3O6/c1-38-27-16-23(17-28(39-2)29(27)40-3)30-32(19-21-10-6-4-7-11-21)26-15-14-24(34(36)37)18-25(26)31(35)33(30)20-22-12-8-5-9-13-22/h4-18,30H,19-20H2,1-3H3/t30-/m0/s1 |
| InChIKey | PCHURLWFAPCIFN-PMERELPUSA-N |
| XLogP | 5.98 |
| TPSA | 94.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|