C36H30ClN3O5 — CID 126120720
(2S)-1,3-dibenzyl-2-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-6-nitro-2H-quinazolin-4-one (PubChem CID 126120720) has the molecular formula C36H30ClN3O5 and a molecular weight of 620.11 g/mol. Its IUPAC name is (2S)-1,3-dibenzyl-2-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-6-nitro-2H-quinazolin-4-one.
| Compound Name | (2S)-1,3-dibenzyl-2-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-6-nitro-2H-quinazolin-4-one |
|---|---|
| PubChem CID | 126120720 |
| Molecular Formula | C36H30ClN3O5 |
| Molecular Weight | 620.11 g/mol |
| Exact Mass | 619.19 |
| IUPAC Name | (2S)-1,3-dibenzyl-2-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-6-nitro-2H-quinazolin-4-one |
| SMILES | COc1cc([C@@H]2N(Cc3ccccc3)C(=O)c3cc([N+](=O)[O-])ccc3N2Cc2ccccc2)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C36H30ClN3O5/c1-44-34-20-28(14-19-33(34)45-24-27-12-15-29(37)16-13-27)35-38(22-25-8-4-2-5-9-25)32-18-17-30(40(42)43)21-31(32)36(41)39(35)23-26-10-6-3-7-11-26/h2-21,35H,22-24H2,1H3/t35-/m0/s1 |
| InChIKey | HKKFFOHRBVDIFQ-DHUJRADRSA-N |
| XLogP | 8.20 |
| TPSA | 85.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.11 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|