C35H28ClN3O4 — CID 126122068
(2S)-1,3-dibenzyl-2-[4-[(4-chlorophenyl)methoxy]phenyl]-6-nitro-2H-quinazolin-4-one (PubChem CID 126122068) has the molecular formula C35H28ClN3O4 and a molecular weight of 590.08 g/mol. Its IUPAC name is (2S)-1,3-dibenzyl-2-[4-[(4-chlorophenyl)methoxy]phenyl]-6-nitro-2H-quinazolin-4-one.
| Compound Name | (2S)-1,3-dibenzyl-2-[4-[(4-chlorophenyl)methoxy]phenyl]-6-nitro-2H-quinazolin-4-one |
|---|---|
| PubChem CID | 126122068 |
| Molecular Formula | C35H28ClN3O4 |
| Molecular Weight | 590.08 g/mol |
| Exact Mass | 589.18 |
| IUPAC Name | (2S)-1,3-dibenzyl-2-[4-[(4-chlorophenyl)methoxy]phenyl]-6-nitro-2H-quinazolin-4-one |
| SMILES | O=C1c2cc([N+](=O)[O-])ccc2N(Cc2ccccc2)[C@H](c2ccc(OCc3ccc(Cl)cc3)cc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C35H28ClN3O4/c36-29-15-11-27(12-16-29)24-43-31-18-13-28(14-19-31)34-37(22-25-7-3-1-4-8-25)33-20-17-30(39(41)42)21-32(33)35(40)38(34)23-26-9-5-2-6-10-26/h1-21,34H,22-24H2/t34-/m0/s1 |
| InChIKey | KIGLYCKIHPBFQG-UMSFTDKQSA-N |
| XLogP | 8.19 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.08 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|