C38H34N4O5 — CID 126128838
2-[4-[(2R)-1,3-dibenzyl-6-nitro-4-oxo-2H-quinazolin-2-yl]phenoxy]-N-[(1S)-1-phenylethyl]acetamide (PubChem CID 126128838) has the molecular formula C38H34N4O5 and a molecular weight of 626.71 g/mol. Its IUPAC name is 2-[4-[(2R)-1,3-dibenzyl-6-nitro-4-oxo-2H-quinazolin-2-yl]phenoxy]-N-[(1S)-1-phenylethyl]acetamide.
| Compound Name | 2-[4-[(2R)-1,3-dibenzyl-6-nitro-4-oxo-2H-quinazolin-2-yl]phenoxy]-N-[(1S)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 126128838 |
| Molecular Formula | C38H34N4O5 |
| Molecular Weight | 626.71 g/mol |
| Exact Mass | 626.25 |
| IUPAC Name | 2-[4-[(2R)-1,3-dibenzyl-6-nitro-4-oxo-2H-quinazolin-2-yl]phenoxy]-N-[(1S)-1-phenylethyl]acetamide |
| SMILES | C[C@H](NC(=O)COc1ccc([C@H]2N(Cc3ccccc3)C(=O)c3cc([N+](=O)[O-])ccc3N2Cc2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C38H34N4O5/c1-27(30-15-9-4-10-16-30)39-36(43)26-47-33-20-17-31(18-21-33)37-40(24-28-11-5-2-6-12-28)35-22-19-32(42(45)46)23-34(35)38(44)41(37)25-29-13-7-3-8-14-29/h2-23,27,37H,24-26H2,1H3,(H,39,43)/t27-,37+/m0/s1 |
| InChIKey | ZESUXNVSSHIRTC-WZPDBAAASA-N |
| XLogP | 7.21 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.71 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|