C37H31Cl2N3O5 — CID 126117153
(2S)-1,3-dibenzyl-2-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-6-nitro-2H-quinazolin-4-one (PubChem CID 126117153) has the molecular formula C37H31Cl2N3O5 and a molecular weight of 668.58 g/mol. Its IUPAC name is (2S)-1,3-dibenzyl-2-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-6-nitro-2H-quinazolin-4-one.
| Compound Name | (2S)-1,3-dibenzyl-2-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-6-nitro-2H-quinazolin-4-one |
|---|---|
| PubChem CID | 126117153 |
| Molecular Formula | C37H31Cl2N3O5 |
| Molecular Weight | 668.58 g/mol |
| Exact Mass | 667.16 |
| IUPAC Name | (2S)-1,3-dibenzyl-2-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-6-nitro-2H-quinazolin-4-one |
| SMILES | CCOc1cc([C@@H]2N(Cc3ccccc3)C(=O)c3cc([N+](=O)[O-])ccc3N2Cc2ccccc2)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C37H31Cl2N3O5/c1-2-46-35-19-27(14-18-34(35)47-24-28-13-15-29(38)20-32(28)39)36-40(22-25-9-5-3-6-10-25)33-17-16-30(42(44)45)21-31(33)37(43)41(36)23-26-11-7-4-8-12-26/h3-21,36H,2,22-24H2,1H3/t36-/m0/s1 |
| InChIKey | AJSDBDUOSLGNIR-BHVANESWSA-N |
| XLogP | 9.24 |
| TPSA | 85.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.58 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|