C19H22O7 — CID 101129564
ethyl (2R,6R)-4,4-dimethyl-9-phenylmethoxy-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undec-9-ene-10-carboxylate (PubChem CID 101129564) has the molecular formula C19H22O7 and a molecular weight of 362.38 g/mol. Its IUPAC name is ethyl (2R,6R)-4,4-dimethyl-9-phenylmethoxy-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undec-9-ene-10-carboxylate.
| Compound Name | ethyl (2R,6R)-4,4-dimethyl-9-phenylmethoxy-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undec-9-ene-10-carboxylate |
|---|---|
| PubChem CID | 101129564 |
| Molecular Formula | C19H22O7 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | ethyl (2R,6R)-4,4-dimethyl-9-phenylmethoxy-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undec-9-ene-10-carboxylate |
| SMILES | CCOC(=O)C1=C(OCc2ccccc2)C2O[C@@H]3OC(C)(C)O[C@@H]3C2O1 |
| InChI | InChI=1S/C19H22O7/c1-4-21-17(20)15-12(22-10-11-8-6-5-7-9-11)13-14(23-15)16-18(24-13)26-19(2,3)25-16/h5-9,13-14,16,18H,4,10H2,1-3H3/t13?,14?,16-,18-/m1/s1 |
| InChIKey | JKVBDAGPZYMJKH-WOVHFWOGSA-N |
| XLogP | 2.25 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |