C24H32O7 — CID 10025802
ethyl (E,5S)-5-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-(2-oxopropyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-5-phenylmethoxypent-2-enoate (PubChem CID 10025802) has the molecular formula C24H32O7 and a molecular weight of 432.51 g/mol. Its IUPAC name is ethyl (E,5S)-5-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-(2-oxopropyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-5-phenylmethoxypent-2-enoate.
| Compound Name | ethyl (E,5S)-5-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-(2-oxopropyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-5-phenylmethoxypent-2-enoate |
|---|---|
| PubChem CID | 10025802 |
| Molecular Formula | C24H32O7 |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | ethyl (E,5S)-5-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-(2-oxopropyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-5-phenylmethoxypent-2-enoate |
| SMILES | CCOC(=O)/C=C/C[C@H](OCc1ccccc1)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1CC(C)=O |
| InChI | InChI=1S/C24H32O7/c1-5-27-20(26)13-9-12-19(28-15-17-10-7-6-8-11-17)21-18(14-16(2)25)22-23(29-21)31-24(3,4)30-22/h6-11,13,18-19,21-23H,5,12,14-15H2,1-4H3/b13-9+/t18-,19+,21+,22-,23-/m1/s1 |
| InChIKey | JIQVCEIJBXGOHV-IQWRFOSVSA-N |
| XLogP | 3.55 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|