C27H31N3O6 — CID 177460011
ethyl (2S)-2-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-benzyltriazol-1-yl)acetate (PubChem CID 177460011) has the molecular formula C27H31N3O6 and a molecular weight of 493.56 g/mol. Its IUPAC name is ethyl (2S)-2-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-benzyltriazol-1-yl)acetate.
| Compound Name | ethyl (2S)-2-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-benzyltriazol-1-yl)acetate |
|---|---|
| PubChem CID | 177460011 |
| Molecular Formula | C27H31N3O6 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | ethyl (2S)-2-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-benzyltriazol-1-yl)acetate |
| SMILES | CCOC(=O)[C@H]([C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1)n1cc(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C27H31N3O6/c1-4-32-25(31)21(30-16-20(28-29-30)15-18-11-7-5-8-12-18)22-23(33-17-19-13-9-6-10-14-19)24-26(34-22)36-27(2,3)35-24/h5-14,16,21-24,26H,4,15,17H2,1-3H3/t21-,22+,23-,24+,26+/m0/s1 |
| InChIKey | AKPZDPYOJZMGJI-SPIJCBKXSA-N |
| XLogP | 3.43 |
| TPSA | 93.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |