C32H47NO7Si — CID 11365295
ethyl (3R)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]propanoate (PubChem CID 11365295) has the molecular formula C32H47NO7Si and a molecular weight of 585.81 g/mol. Its IUPAC name is ethyl (3R)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]propanoate.
| Compound Name | ethyl (3R)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]propanoate |
|---|---|
| PubChem CID | 11365295 |
| Molecular Formula | C32H47NO7Si |
| Molecular Weight | 585.81 g/mol |
| Exact Mass | 585.31 |
| IUPAC Name | ethyl (3R)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]propanoate |
| SMILES | CCOC(=O)C[C@H]([C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1)N(Cc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H47NO7Si/c1-9-35-26(34)20-25(33(21-23-16-12-10-13-17-23)40-41(7,8)31(2,3)4)27-28(36-22-24-18-14-11-15-19-24)29-30(37-27)39-32(5,6)38-29/h10-19,25,27-30H,9,20-22H2,1-8H3/t25-,27-,28+,29-,30-/m1/s1 |
| InChIKey | AFBQEQSRDAGFOB-LXRLAABLSA-N |
| XLogP | 6.21 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.81 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|