C15H23NO7 — CID 102354892
ethyl (1S,2R,4R,8R,9S,12S)-6,6,14-trimethyl-3,5,7,10,13-pentaoxa-14-azatetracyclo[10.2.1.02,9.04,8]pentadecane-12-carboxylate (PubChem CID 102354892) has the molecular formula C15H23NO7 and a molecular weight of 329.35 g/mol. Its IUPAC name is ethyl (1S,2R,4R,8R,9S,12S)-6,6,14-trimethyl-3,5,7,10,13-pentaoxa-14-azatetracyclo[10.2.1.02,9.04,8]pentadecane-12-carboxylate.
| Compound Name | ethyl (1S,2R,4R,8R,9S,12S)-6,6,14-trimethyl-3,5,7,10,13-pentaoxa-14-azatetracyclo[10.2.1.02,9.04,8]pentadecane-12-carboxylate |
|---|---|
| PubChem CID | 102354892 |
| Molecular Formula | C15H23NO7 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | ethyl (1S,2R,4R,8R,9S,12S)-6,6,14-trimethyl-3,5,7,10,13-pentaoxa-14-azatetracyclo[10.2.1.02,9.04,8]pentadecane-12-carboxylate |
| SMILES | CCOC(=O)[C@@]12CO[C@@H]3[C@H]4OC(C)(C)O[C@H]4O[C@@H]3[C@H](C1)N(C)O2 |
| InChI | InChI=1S/C15H23NO7/c1-5-18-13(17)15-6-8(16(4)23-15)9-10(19-7-15)11-12(20-9)22-14(2,3)21-11/h8-12H,5-7H2,1-4H3/t8-,9+,10-,11+,12+,15-/m0/s1 |
| InChIKey | UHQMRQYYODJXBL-XBXRNYETSA-N |
| XLogP | 0.20 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |