C14H21NO7 — CID 101145774
methyl (1R,2S,5R,6S,9S,10R,14R)-3,12,12-trimethyl-4,8,11,13,15-pentaoxa-3-azatetracyclo[7.6.0.02,6.010,14]pentadecane-5-carboxylate (PubChem CID 101145774) has the molecular formula C14H21NO7 and a molecular weight of 315.32 g/mol. Its IUPAC name is methyl (1R,2S,5R,6S,9S,10R,14R)-3,12,12-trimethyl-4,8,11,13,15-pentaoxa-3-azatetracyclo[7.6.0.02,6.010,14]pentadecane-5-carboxylate.
| Compound Name | methyl (1R,2S,5R,6S,9S,10R,14R)-3,12,12-trimethyl-4,8,11,13,15-pentaoxa-3-azatetracyclo[7.6.0.02,6.010,14]pentadecane-5-carboxylate |
|---|---|
| PubChem CID | 101145774 |
| Molecular Formula | C14H21NO7 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | methyl (1R,2S,5R,6S,9S,10R,14R)-3,12,12-trimethyl-4,8,11,13,15-pentaoxa-3-azatetracyclo[7.6.0.02,6.010,14]pentadecane-5-carboxylate |
| SMILES | COC(=O)[C@@H]1ON(C)[C@H]2[C@H]1CO[C@@H]1[C@H]3OC(C)(C)O[C@H]3O[C@@H]12 |
| InChI | InChI=1S/C14H21NO7/c1-14(2)20-11-10-9(19-13(11)21-14)7-6(5-18-10)8(12(16)17-4)22-15(7)3/h6-11,13H,5H2,1-4H3/t6-,7+,8-,9-,10+,11-,13-/m1/s1 |
| InChIKey | STCKGIHXUVGSBZ-UEWVPMGMSA-N |
| XLogP | -0.34 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |