C17H25F3N2O9 — CID 71747595
methyl (1S,2R,6R,8R,9S,10R)-9-[[(2S)-2-aminopropanoyl]amino]-4,4-dimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecane-10-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 71747595) has the molecular formula C17H25F3N2O9 and a molecular weight of 458.39 g/mol. Its IUPAC name is methyl (1S,2R,6R,8R,9S,10R)-9-[[(2S)-2-aminopropanoyl]amino]-4,4-dimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecane-10-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl (1S,2R,6R,8R,9S,10R)-9-[[(2S)-2-aminopropanoyl]amino]-4,4-dimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecane-10-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 71747595 |
| Molecular Formula | C17H25F3N2O9 |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | methyl (1S,2R,6R,8R,9S,10R)-9-[[(2S)-2-aminopropanoyl]amino]-4,4-dimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecane-10-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | COC(=O)[C@H]1CO[C@H]2[C@H](O[C@@H]3OC(C)(C)O[C@@H]32)[C@H]1NC(=O)[C@H](C)N.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H24N2O7.C2HF3O2/c1-6(16)12(18)17-8-7(13(19)20-4)5-21-10-9(8)22-14-11(10)23-15(2,3)24-14;3-2(4,5)1(6)7/h6-11,14H,5,16H2,1-4H3,(H,17,18);(H,6,7)/t6-,7-,8-,9+,10-,11+,14+;/m0./s1 |
| InChIKey | GKXRQWSESSWNIY-VZQGYQOBSA-N |
| XLogP | -0.48 |
| TPSA | 155.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |