C15H22O8 — CID 132597117
oxiran-2-ylmethyl (1S,2R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxylate (PubChem CID 132597117) has the molecular formula C15H22O8 and a molecular weight of 330.33 g/mol. Its IUPAC name is oxiran-2-ylmethyl (1S,2R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxylate.
| Compound Name | oxiran-2-ylmethyl (1S,2R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxylate |
|---|---|
| PubChem CID | 132597117 |
| Molecular Formula | C15H22O8 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | oxiran-2-ylmethyl (1S,2R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxylate |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H]1OC(C)(C)OC1O[C@@H]2C(=O)OCC1CO1 |
| InChI | InChI=1S/C15H22O8/c1-14(2)20-8-9(21-14)11-13(23-15(3,4)22-11)19-10(8)12(16)18-6-7-5-17-7/h7-11,13H,5-6H2,1-4H3/t7?,8-,9+,10+,11-,13?/m1/s1 |
| InChIKey | JWBFXTANLSCVSV-BROKJFOISA-N |
| XLogP | 0.32 |
| TPSA | 84.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|