C18H22O7 — CID 11863747
phenyl (1S,2R,6S,8R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxylate (PubChem CID 11863747) has the molecular formula C18H22O7 and a molecular weight of 350.37 g/mol. Its IUPAC name is phenyl (1S,2R,6S,8R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxylate.
| Compound Name | phenyl (1S,2R,6S,8R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxylate |
|---|---|
| PubChem CID | 11863747 |
| Molecular Formula | C18H22O7 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | phenyl (1S,2R,6S,8R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxylate |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@H](C(=O)Oc1ccccc1)O[C@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C18H22O7/c1-17(2)22-11-12(23-17)14-16(25-18(3,4)24-14)21-13(11)15(19)20-10-8-6-5-7-9-10/h5-9,11-14,16H,1-4H3/t11-,12+,13-,14-,16+/m1/s1 |
| InChIKey | AYUOOUUEVWCLKN-SGPHBRAGSA-N |
| XLogP | 1.99 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|