C22H24O7 — CID 11888673
naphthalen-2-yl (1R,2R,6S,8R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxylate (PubChem CID 11888673) has the molecular formula C22H24O7 and a molecular weight of 400.43 g/mol. Its IUPAC name is naphthalen-2-yl (1R,2R,6S,8R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxylate.
| Compound Name | naphthalen-2-yl (1R,2R,6S,8R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxylate |
|---|---|
| PubChem CID | 11888673 |
| Molecular Formula | C22H24O7 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | naphthalen-2-yl (1R,2R,6S,8R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxylate |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)[C@H](C(=O)Oc1ccc3ccccc3c1)O[C@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C22H24O7/c1-21(2)26-15-16(27-21)18-20(29-22(3,4)28-18)25-17(15)19(23)24-14-10-9-12-7-5-6-8-13(12)11-14/h5-11,15-18,20H,1-4H3/t15-,16-,17-,18-,20+/m1/s1 |
| InChIKey | ZDCHMLLJWMHZBP-VBEQINLCSA-N |
| XLogP | 3.14 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|