C28H30N2O7 — CID 71816352
(11S,15S,16S,20S,24Z)-20-benzyl-13,13-dimethyl-5,7,12,14,22-pentaoxa-1,19-diazapentacyclo[14.10.0.02,10.04,8.011,15]hexacosa-2,4(8),9,24-tetraene-18,21-dione (PubChem CID 71816352) has the molecular formula C28H30N2O7 and a molecular weight of 506.56 g/mol. Its IUPAC name is (11S,15S,16S,20S,24Z)-20-benzyl-13,13-dimethyl-5,7,12,14,22-pentaoxa-1,19-diazapentacyclo[14.10.0.02,10.04,8.011,15]hexacosa-2,4(8),9,24-tetraene-18,21-dione.
| Compound Name | (11S,15S,16S,20S,24Z)-20-benzyl-13,13-dimethyl-5,7,12,14,22-pentaoxa-1,19-diazapentacyclo[14.10.0.02,10.04,8.011,15]hexacosa-2,4(8),9,24-tetraene-18,21-dione |
|---|---|
| PubChem CID | 71816352 |
| Molecular Formula | C28H30N2O7 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | (11S,15S,16S,20S,24Z)-20-benzyl-13,13-dimethyl-5,7,12,14,22-pentaoxa-1,19-diazapentacyclo[14.10.0.02,10.04,8.011,15]hexacosa-2,4(8),9,24-tetraene-18,21-dione |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)c1cc3c(cc1N1C/C=C\COC(=O)[C@H](Cc4ccccc4)NC(=O)C[C@@H]21)OCO3 |
| InChI | InChI=1S/C28H30N2O7/c1-28(2)36-25-18-13-22-23(35-16-34-22)14-20(18)30-10-6-7-11-33-27(32)19(12-17-8-4-3-5-9-17)29-24(31)15-21(30)26(25)37-28/h3-9,13-14,19,21,25-26H,10-12,15-16H2,1-2H3,(H,29,31)/b7-6-/t19-,21-,25-,26-/m0/s1 |
| InChIKey | UGWKBVOUMXZLTB-XVYNABDOSA-N |
| XLogP | 3.03 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|