C30H42N2O8 — CID 126480079
(3S,7E,9R,10S,14S,18E,20R)-3-benzyl-10,21-dimethoxy-9,14,20-trimethyl-1,12-dioxa-4,15-diazacyclodocosa-7,18-diene-2,5,13,16-tetrone (PubChem CID 126480079) has the molecular formula C30H42N2O8 and a molecular weight of 558.67 g/mol. Its IUPAC name is (3S,7E,9R,10S,14S,18E,20R)-3-benzyl-10,21-dimethoxy-9,14,20-trimethyl-1,12-dioxa-4,15-diazacyclodocosa-7,18-diene-2,5,13,16-tetrone.
| Compound Name | (3S,7E,9R,10S,14S,18E,20R)-3-benzyl-10,21-dimethoxy-9,14,20-trimethyl-1,12-dioxa-4,15-diazacyclodocosa-7,18-diene-2,5,13,16-tetrone |
|---|---|
| PubChem CID | 126480079 |
| Molecular Formula | C30H42N2O8 |
| Molecular Weight | 558.67 g/mol |
| Exact Mass | 558.29 |
| IUPAC Name | (3S,7E,9R,10S,14S,18E,20R)-3-benzyl-10,21-dimethoxy-9,14,20-trimethyl-1,12-dioxa-4,15-diazacyclodocosa-7,18-diene-2,5,13,16-tetrone |
| SMILES | COC1COC(=O)[C@H](Cc2ccccc2)NC(=O)C/C=C/[C@@H](C)[C@H](OC)COC(=O)[C@H](C)NC(=O)C/C=C/[C@H]1C |
| InChI | InChI=1S/C30H42N2O8/c1-20-12-10-16-28(34)32-24(17-23-13-7-6-8-14-23)30(36)40-19-26(38-5)21(2)11-9-15-27(33)31-22(3)29(35)39-18-25(20)37-4/h6-14,20-22,24-26H,15-19H2,1-5H3,(H,31,33)(H,32,34)/b11-9+,12-10+/t20-,21-,22+,24+,25-,26?/m1/s1 |
| InChIKey | NDMZHZXJCWIFEN-BYQJZRGZSA-N |
| XLogP | 2.51 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.67 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|