C23H31NO7 — CID 16758289
(3R,7Z,9R,10R,14S)-10-methoxy-9,14-dimethyl-3-(phenylmethoxymethyl)-1,12-dioxa-4-azacyclopentadec-7-ene-2,5,13-trione (PubChem CID 16758289) has the molecular formula C23H31NO7 and a molecular weight of 433.50 g/mol. Its IUPAC name is (3R,7Z,9R,10R,14S)-10-methoxy-9,14-dimethyl-3-(phenylmethoxymethyl)-1,12-dioxa-4-azacyclopentadec-7-ene-2,5,13-trione.
| Compound Name | (3R,7Z,9R,10R,14S)-10-methoxy-9,14-dimethyl-3-(phenylmethoxymethyl)-1,12-dioxa-4-azacyclopentadec-7-ene-2,5,13-trione |
|---|---|
| PubChem CID | 16758289 |
| Molecular Formula | C23H31NO7 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | (3R,7Z,9R,10R,14S)-10-methoxy-9,14-dimethyl-3-(phenylmethoxymethyl)-1,12-dioxa-4-azacyclopentadec-7-ene-2,5,13-trione |
| SMILES | CO[C@H]1COC(=O)[C@@H](C)COC(=O)[C@@H](COCc2ccccc2)NC(=O)C/C=C\[C@H]1C |
| InChI | InChI=1S/C23H31NO7/c1-16-8-7-11-21(25)24-19(14-29-13-18-9-5-4-6-10-18)23(27)30-12-17(2)22(26)31-15-20(16)28-3/h4-10,16-17,19-20H,11-15H2,1-3H3,(H,24,25)/b8-7-/t16-,17+,19-,20+/m1/s1 |
| InChIKey | BYRBRRVPQFPPQY-HLOGUZDPSA-N |
| XLogP | 2.02 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|