C17H22O4 — CID 11254785
(4R,4aS,6S,7S,7aS)-6-hydroxy-4-methyl-7-(phenylmethoxymethyl)-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyran-3-one (PubChem CID 11254785) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is (4R,4aS,6S,7S,7aS)-6-hydroxy-4-methyl-7-(phenylmethoxymethyl)-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyran-3-one.
| Compound Name | (4R,4aS,6S,7S,7aS)-6-hydroxy-4-methyl-7-(phenylmethoxymethyl)-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyran-3-one |
|---|---|
| PubChem CID | 11254785 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (4R,4aS,6S,7S,7aS)-6-hydroxy-4-methyl-7-(phenylmethoxymethyl)-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyran-3-one |
| SMILES | C[C@H]1C(=O)OC[C@@H]2[C@@H](COCc3ccccc3)[C@@H](O)C[C@@H]21 |
| InChI | InChI=1S/C17H22O4/c1-11-13-7-16(18)15(14(13)10-21-17(11)19)9-20-8-12-5-3-2-4-6-12/h2-6,11,13-16,18H,7-10H2,1H3/t11-,13-,14+,15-,16+/m1/s1 |
| InChIKey | ADBBXPCDRMMHDC-JZYAIQKZSA-N |
| XLogP | 2.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |