C28H39NO8 — CID 6636501
(3S,9R,10S,17R,18S)-10,18-dimethoxy-9,17-dimethyl-3-(phenylmethoxymethyl)-1,12-dioxa-4-azacyclononadeca-7,15-diene-2,5,13-trione (PubChem CID 6636501) has the molecular formula C28H39NO8 and a molecular weight of 517.62 g/mol. Its IUPAC name is (3S,9R,10S,17R,18S)-10,18-dimethoxy-9,17-dimethyl-3-(phenylmethoxymethyl)-1,12-dioxa-4-azacyclononadeca-7,15-diene-2,5,13-trione.
| Compound Name | (3S,9R,10S,17R,18S)-10,18-dimethoxy-9,17-dimethyl-3-(phenylmethoxymethyl)-1,12-dioxa-4-azacyclononadeca-7,15-diene-2,5,13-trione |
|---|---|
| PubChem CID | 6636501 |
| Molecular Formula | C28H39NO8 |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | (3S,9R,10S,17R,18S)-10,18-dimethoxy-9,17-dimethyl-3-(phenylmethoxymethyl)-1,12-dioxa-4-azacyclononadeca-7,15-diene-2,5,13-trione |
| SMILES | CO[C@@H]1COC(=O)CC=C[C@@H](C)[C@H](OC)COC(=O)[C@H](COCc2ccccc2)NC(=O)CC=C[C@H]1C |
| InChI | InChI=1S/C28H39NO8/c1-20-10-8-14-26(30)29-23(17-35-16-22-12-6-5-7-13-22)28(32)37-19-25(34-4)21(2)11-9-15-27(31)36-18-24(20)33-3/h5-13,20-21,23-25H,14-19H2,1-4H3,(H,29,30)/t20-,21-,23+,24-,25-/m1/s1 |
| InChIKey | DWUDGWBPRCGTDK-SPCXXQJASA-N |
| XLogP | 2.98 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|