C24H38N2O6S2 — CID 6419651
(3S,7E,9R,13S,17E,19R)-9,19-dimethyl-3,13-bis(2-methylsulfanylethyl)-1,11-dioxa-4,14-diazacycloicosa-7,17-diene-2,5,12,15-tetrone (PubChem CID 6419651) has the molecular formula C24H38N2O6S2 and a molecular weight of 514.71 g/mol. Its IUPAC name is (3S,7E,9R,13S,17E,19R)-9,19-dimethyl-3,13-bis(2-methylsulfanylethyl)-1,11-dioxa-4,14-diazacycloicosa-7,17-diene-2,5,12,15-tetrone.
| Compound Name | (3S,7E,9R,13S,17E,19R)-9,19-dimethyl-3,13-bis(2-methylsulfanylethyl)-1,11-dioxa-4,14-diazacycloicosa-7,17-diene-2,5,12,15-tetrone |
|---|---|
| PubChem CID | 6419651 |
| Molecular Formula | C24H38N2O6S2 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | (3S,7E,9R,13S,17E,19R)-9,19-dimethyl-3,13-bis(2-methylsulfanylethyl)-1,11-dioxa-4,14-diazacycloicosa-7,17-diene-2,5,12,15-tetrone |
| SMILES | CSCC[C@@H]1NC(=O)C/C=C/[C@@H](C)COC(=O)[C@H](CCSC)NC(=O)C/C=C/[C@@H](C)COC1=O |
| InChI | InChI=1S/C24H38N2O6S2/c1-17-7-5-9-21(27)26-20(12-14-34-4)24(30)32-16-18(2)8-6-10-22(28)25-19(11-13-33-3)23(29)31-15-17/h5-8,17-20H,9-16H2,1-4H3,(H,25,28)(H,26,27)/b7-5+,8-6+/t17-,18-,19+,20+/m1/s1 |
| InChIKey | FVHUOHJFRQCFMX-RSZCOJRZSA-N |
| XLogP | 2.73 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|