C13H23NO4S — CID 16758355
methyl (2S)-2-[[(Z,5R)-6-hydroxy-5-methylhex-3-enoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 16758355) has the molecular formula C13H23NO4S and a molecular weight of 289.40 g/mol. Its IUPAC name is methyl (2S)-2-[[(Z,5R)-6-hydroxy-5-methylhex-3-enoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2S)-2-[[(Z,5R)-6-hydroxy-5-methylhex-3-enoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 16758355 |
| Molecular Formula | C13H23NO4S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | methyl (2S)-2-[[(Z,5R)-6-hydroxy-5-methylhex-3-enoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)[C@H](CCSC)NC(=O)C/C=C\[C@@H](C)CO |
| InChI | InChI=1S/C13H23NO4S/c1-10(9-15)5-4-6-12(16)14-11(7-8-19-3)13(17)18-2/h4-5,10-11,15H,6-9H2,1-3H3,(H,14,16)/b5-4-/t10-,11+/m1/s1 |
| InChIKey | UNZKGGQDOMDFMB-KWKBKKAHSA-N |
| XLogP | 0.97 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|