C13H12O4 — CID 71220428
(5aR,8aR)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-6-one (PubChem CID 71220428) has the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. Its IUPAC name is (5aR,8aR)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-6-one.
| Compound Name | (5aR,8aR)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-6-one |
|---|---|
| PubChem CID | 71220428 |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | (5aR,8aR)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-6-one |
| SMILES | O=C1OC[C@@H]2Cc3cc4c(cc3C[C@@H]12)OCO4 |
| InChI | InChI=1S/C13H12O4/c14-13-10-2-8-4-12-11(16-6-17-12)3-7(8)1-9(10)5-15-13/h3-4,9-10H,1-2,5-6H2/t9-,10+/m0/s1 |
| InChIKey | KDAVTDIQCUOJNV-VHSXEESVSA-N |
| XLogP | 1.30 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |