C13H14O5S — CID 154163930
(6R,8S)-8-methyl-7-oxo-5,6,8,9-tetrahydrothiepino[4,5-f][1,3]benzodioxole-6-carboxylic acid (PubChem CID 154163930) has the molecular formula C13H14O5S and a molecular weight of 282.32 g/mol. Its IUPAC name is (6R,8S)-8-methyl-7-oxo-5,6,8,9-tetrahydrothiepino[4,5-f][1,3]benzodioxole-6-carboxylic acid.
| Compound Name | (6R,8S)-8-methyl-7-oxo-5,6,8,9-tetrahydrothiepino[4,5-f][1,3]benzodioxole-6-carboxylic acid |
|---|---|
| PubChem CID | 154163930 |
| Molecular Formula | C13H14O5S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | (6R,8S)-8-methyl-7-oxo-5,6,8,9-tetrahydrothiepino[4,5-f][1,3]benzodioxole-6-carboxylic acid |
| SMILES | CC1Cc2cc3c(cc2C[C@H](C(=O)O)S1=O)OCO3 |
| InChI | InChI=1S/C13H14O5S/c1-7-2-8-3-10-11(18-6-17-10)4-9(8)5-12(13(14)15)19(7)16/h3-4,7,12H,2,5-6H2,1H3,(H,14,15)/t7?,12-,19?/m1/s1 |
| InChIKey | SDEQKYUAGQCCOW-IBTBSANVSA-N |
| XLogP | 1.10 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |