C18H21NO4 — CID 134094557
2-butyl-4-methyl-3a,4,5,10b-tetrahydro-[1,3]benzodioxolo[6,5-e]isoindole-1,3-dione (PubChem CID 134094557) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-butyl-4-methyl-3a,4,5,10b-tetrahydro-[1,3]benzodioxolo[6,5-e]isoindole-1,3-dione.
| Compound Name | 2-butyl-4-methyl-3a,4,5,10b-tetrahydro-[1,3]benzodioxolo[6,5-e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134094557 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 2-butyl-4-methyl-3a,4,5,10b-tetrahydro-[1,3]benzodioxolo[6,5-e]isoindole-1,3-dione |
| SMILES | CCCCN1C(=O)C2c3cc4c(cc3CC(C)C2C1=O)OCO4 |
| InChI | InChI=1S/C18H21NO4/c1-3-4-5-19-17(20)15-10(2)6-11-7-13-14(23-9-22-13)8-12(11)16(15)18(19)21/h7-8,10,15-16H,3-6,9H2,1-2H3 |
| InChIKey | WNBJUCATKNSHCL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|