C9H7ClO2 — CID 7055858
(4R)-4-chloro-9,11-dioxatricyclo[6.3.0.03,6]undeca-1(8),2,6-triene (PubChem CID 7055858) has the molecular formula C9H7ClO2 and a molecular weight of 182.61 g/mol. Its IUPAC name is (4R)-4-chloro-9,11-dioxatricyclo[6.3.0.03,6]undeca-1(8),2,6-triene.
| Compound Name | (4R)-4-chloro-9,11-dioxatricyclo[6.3.0.03,6]undeca-1(8),2,6-triene |
|---|---|
| PubChem CID | 7055858 |
| Molecular Formula | C9H7ClO2 |
| Molecular Weight | 182.61 g/mol |
| Exact Mass | 182.01 |
| IUPAC Name | (4R)-4-chloro-9,11-dioxatricyclo[6.3.0.03,6]undeca-1(8),2,6-triene |
| SMILES | Cl[C@@H]1Cc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C9H7ClO2/c10-7-1-5-2-8-9(3-6(5)7)12-4-11-8/h2-3,7H,1,4H2/t7-/m1/s1 |
| InChIKey | VHFKQJKWPOUEDS-SSDOTTSWSA-N |
| XLogP | 2.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.61 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_465_misc(1)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|