C17H15NO4 — CID 4643659
5-(1,3-benzodioxol-5-yl)-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinoline (PubChem CID 4643659) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinoline.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinoline |
|---|---|
| PubChem CID | 4643659 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinoline |
| SMILES | c1cc2c(cc1C1NCCc3cc4c(cc31)OCO4)OCO2 |
| InChI | InChI=1S/C17H15NO4/c1-2-13-14(20-8-19-13)6-11(1)17-12-7-16-15(21-9-22-16)5-10(12)3-4-18-17/h1-2,5-7,17-18H,3-4,8-9H2 |
| InChIKey | CBMHXZRJCBMDGG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |