C17H17NO2 — CID 11196421
(1R)-1-(1,3-benzodioxol-5-yl)-2,3,4,5-tetrahydro-1H-2-benzazepine (PubChem CID 11196421) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is (1R)-1-(1,3-benzodioxol-5-yl)-2,3,4,5-tetrahydro-1H-2-benzazepine.
| Compound Name | (1R)-1-(1,3-benzodioxol-5-yl)-2,3,4,5-tetrahydro-1H-2-benzazepine |
|---|---|
| PubChem CID | 11196421 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (1R)-1-(1,3-benzodioxol-5-yl)-2,3,4,5-tetrahydro-1H-2-benzazepine |
| SMILES | c1ccc2c(c1)CCCN[C@@H]2c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H17NO2/c1-2-6-14-12(4-1)5-3-9-18-17(14)13-7-8-15-16(10-13)20-11-19-15/h1-2,4,6-8,10,17-18H,3,5,9,11H2/t17-/m1/s1 |
| InChIKey | GAGVJEYLUOMBFG-QGZVFWFLSA-N |
| XLogP | 3.04 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |