C20H20O3 — CID 56958915
(4R,4aR,10bS)-4-(1,3-benzodioxol-5-yl)-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isochromene (PubChem CID 56958915) has the molecular formula C20H20O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is (4R,4aR,10bS)-4-(1,3-benzodioxol-5-yl)-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isochromene.
| Compound Name | (4R,4aR,10bS)-4-(1,3-benzodioxol-5-yl)-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isochromene |
|---|---|
| PubChem CID | 56958915 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (4R,4aR,10bS)-4-(1,3-benzodioxol-5-yl)-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isochromene |
| SMILES | c1ccc2c(c1)CC[C@@H]1[C@@H]2CCO[C@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H20O3/c1-2-4-15-13(3-1)5-7-17-16(15)9-10-21-20(17)14-6-8-18-19(11-14)23-12-22-18/h1-4,6,8,11,16-17,20H,5,7,9-10,12H2/t16-,17-,20+/m1/s1 |
| InChIKey | HEWLIMHMVDJRBU-HLIPFELVSA-N |
| XLogP | 4.22 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |