C26H22O8 — CID 101407475
2-[[6-[(3R,3aR,6S,6aR)-3-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-1,3-benzodioxol-5-yl]oxy]phenol (PubChem CID 101407475) has the molecular formula C26H22O8 and a molecular weight of 462.45 g/mol. Its IUPAC name is 2-[[6-[(3R,3aR,6S,6aR)-3-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-1,3-benzodioxol-5-yl]oxy]phenol.
| Compound Name | 2-[[6-[(3R,3aR,6S,6aR)-3-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-1,3-benzodioxol-5-yl]oxy]phenol |
|---|---|
| PubChem CID | 101407475 |
| Molecular Formula | C26H22O8 |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 2-[[6-[(3R,3aR,6S,6aR)-3-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-1,3-benzodioxol-5-yl]oxy]phenol |
| SMILES | Oc1ccccc1Oc1cc2c(cc1[C@H]1OC[C@H]3[C@@H]1CO[C@H]3c1ccc3c(c1)OCO3)OCO2 |
| InChI | InChI=1S/C26H22O8/c27-18-3-1-2-4-19(18)34-21-9-24-23(32-13-33-24)8-15(21)26-17-11-28-25(16(17)10-29-26)14-5-6-20-22(7-14)31-12-30-20/h1-9,16-17,25-27H,10-13H2/t16-,17-,25-,26+/m0/s1 |
| InChIKey | LNKOYWQYULGQBW-BZXROKRSSA-N |
| XLogP | 4.72 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |