C20H18O7 — CID 68666147
6-[(3aR,6aS)-3-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-1,3-benzodioxol-5-ol (PubChem CID 68666147) has the molecular formula C20H18O7 and a molecular weight of 370.36 g/mol. Its IUPAC name is 6-[(3aR,6aS)-3-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[(3aR,6aS)-3-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 68666147 |
| Molecular Formula | C20H18O7 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 6-[(3aR,6aS)-3-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-1,3-benzodioxol-5-ol |
| SMILES | Oc1cc2c(cc1C1OC[C@@H]3C(c4ccc5c(c4)OCO5)OC[C@@H]13)OCO2 |
| InChI | InChI=1S/C20H18O7/c21-14-5-18-17(26-9-27-18)4-11(14)20-13-7-22-19(12(13)6-23-20)10-1-2-15-16(3-10)25-8-24-15/h1-5,12-13,19-21H,6-9H2/t12-,13+,19?,20?/m0/s1 |
| InChIKey | KQRXQIPRDKVZPW-UEXLUJBTSA-N |
| XLogP | 2.92 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |