C17H17NO2 — CID 43202744
N-(1,3-benzodioxol-5-ylmethyl)-2,3-dihydro-1H-inden-1-amine (PubChem CID 43202744) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2,3-dihydro-1H-inden-1-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 43202744 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2,3-dihydro-1H-inden-1-amine |
| SMILES | c1ccc2c(c1)CCC2NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H17NO2/c1-2-4-14-13(3-1)6-7-15(14)18-10-12-5-8-16-17(9-12)20-11-19-16/h1-5,8-9,15,18H,6-7,10-11H2 |
| InChIKey | FEMVZZMPWSEYHX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |