4-[(2,3-dihydro-1H-inden-1-ylamino)methyl]benzenesulfinic acid

C16H17NO2S — CID 118861554

IUPAC4-[(2,3-dihydro-1H-inden-1-ylamino)methyl]benzenesulfinic acid
SMILESO=S(O)c1ccc(CNC2CCc3ccccc32)cc1
InChIInChI=1S/C16H17NO2S/c18-20(19)14-8-5-12(6-9-14)11-17-16-10-7-13-3-1-2-4-15(13)16/h1-6,8-9,16-17H,7,10-11H2,(H,18,19)
InChIKeySEDJKXKYYVRNJZ-UHFFFAOYSA-N
MW287.38 g/mol
LogP3.04
Rot. Bonds4

About 4-[(2,3-dihydro-1H-inden-1-ylamino)methyl]benzenesulfinic acid

4-[(2,3-dihydro-1H-inden-1-ylamino)methyl]benzenesulfinic acid (PubChem CID 118861554) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is 4-[(2,3-dihydro-1H-inden-1-ylamino)methyl]benzenesulfinic acid.

Molecular Properties

Compound Name4-[(2,3-dihydro-1H-inden-1-ylamino)methyl]benzenesulfinic acid
PubChem CID118861554
Molecular FormulaC16H17NO2S
Molecular Weight287.38 g/mol
Exact Mass287.10
IUPAC Name4-[(2,3-dihydro-1H-inden-1-ylamino)methyl]benzenesulfinic acid
SMILESO=S(O)c1ccc(CNC2CCc3ccccc32)cc1
InChIInChI=1S/C16H17NO2S/c18-20(19)14-8-5-12(6-9-14)11-17-16-10-7-13-3-1-2-4-15(13)16/h1-6,8-9,16-17H,7,10-11H2,(H,18,19)
InChIKeySEDJKXKYYVRNJZ-UHFFFAOYSA-N
XLogP3.04
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.38
LogP ≤ 53.04
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze 4-[(2,3-dihydro-1H-inden-1-ylamino)methyl]benzenesulfinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2,3-dihydro-1H-inden-1-ylamino)methyl]benzenesulfinic acid?
The IUPAC name of 4-[(2,3-dihydro-1H-inden-1-ylamino)methyl]benzenesulfinic acid (CID 118861554) is 4-[(2,3-dihydro-1H-inden-1-ylamino)methyl]benzenesulfinic acid.
What is the SMILES notation for 4-[(2,3-dihydro-1H-inden-1-ylamino)methyl]benzenesulfinic acid?
The canonical SMILES for 4-[(2,3-dihydro-1H-inden-1-ylamino)methyl]benzenesulfinic acid is O=S(O)c1ccc(CNC2CCc3ccccc32)cc1.
What is the InChIKey of 4-[(2,3-dihydro-1H-inden-1-ylamino)methyl]benzenesulfinic acid?
The InChIKey is SEDJKXKYYVRNJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO2S/c18-20(19)14-8-5-12(6-9-14)11-17-16-10-7-13-3-1-2-4-15(13)16/h1-6,8-9,16-17H,7,10-11H2,(H,18,19).
What are the key properties of 4-[(2,3-dihydro-1H-inden-1-ylamino)methyl]benzenesulfinic acid?
4-[(2,3-dihydro-1H-inden-1-ylamino)methyl]benzenesulfinic acid has a molecular weight of 287.38 g/mol, XLogP of 3.04, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,3-dihydro-1H-inden-1-ylamino)methyl]benzenesulfinic acid is sourced from PubChem (CID 118861554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).