C16H17NO2S — CID 118861554
4-[(2,3-dihydro-1H-inden-1-ylamino)methyl]benzenesulfinic acid (PubChem CID 118861554) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is 4-[(2,3-dihydro-1H-inden-1-ylamino)methyl]benzenesulfinic acid.
| Compound Name | 4-[(2,3-dihydro-1H-inden-1-ylamino)methyl]benzenesulfinic acid |
|---|---|
| PubChem CID | 118861554 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 4-[(2,3-dihydro-1H-inden-1-ylamino)methyl]benzenesulfinic acid |
| SMILES | O=S(O)c1ccc(CNC2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C16H17NO2S/c18-20(19)14-8-5-12(6-9-14)11-17-16-10-7-13-3-1-2-4-15(13)16/h1-6,8-9,16-17H,7,10-11H2,(H,18,19) |
| InChIKey | SEDJKXKYYVRNJZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|