C12H15F2NO2S — CID 58691871
3-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-2,2-difluoropropane-1-sulfinic acid (PubChem CID 58691871) has the molecular formula C12H15F2NO2S and a molecular weight of 275.32 g/mol. Its IUPAC name is 3-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-2,2-difluoropropane-1-sulfinic acid.
| Compound Name | 3-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-2,2-difluoropropane-1-sulfinic acid |
|---|---|
| PubChem CID | 58691871 |
| Molecular Formula | C12H15F2NO2S |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 3-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-2,2-difluoropropane-1-sulfinic acid |
| SMILES | O=S(O)CC(F)(F)CN[C@@H]1CCc2ccccc21 |
| InChI | InChI=1S/C12H15F2NO2S/c13-12(14,8-18(16)17)7-15-11-6-5-9-3-1-2-4-10(9)11/h1-4,11,15H,5-8H2,(H,16,17)/t11-/m1/s1 |
| InChIKey | RMBMIEBUNUDURE-LLVKDONJSA-N |
| XLogP | 2.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|