C12H15F2NO3S — CID 58691898
3-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-2,2-difluoropropane-1-sulfonic acid (PubChem CID 58691898) has the molecular formula C12H15F2NO3S and a molecular weight of 291.32 g/mol. Its IUPAC name is 3-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-2,2-difluoropropane-1-sulfonic acid.
| Compound Name | 3-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-2,2-difluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 58691898 |
| Molecular Formula | C12H15F2NO3S |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 3-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-2,2-difluoropropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CC(F)(F)CN[C@@H]1CCc2ccccc21 |
| InChI | InChI=1S/C12H15F2NO3S/c13-12(14,8-19(16,17)18)7-15-11-6-5-9-3-1-2-4-10(9)11/h1-4,11,15H,5-8H2,(H,16,17,18)/t11-/m1/s1 |
| InChIKey | BDNFZFZCLMILEK-LLVKDONJSA-N |
| XLogP | 1.79 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|