C12H16FNO3S — CID 58691893
(2S)-3-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-2-fluoropropane-1-sulfonic acid (PubChem CID 58691893) has the molecular formula C12H16FNO3S and a molecular weight of 273.33 g/mol. Its IUPAC name is (2S)-3-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-2-fluoropropane-1-sulfonic acid.
| Compound Name | (2S)-3-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-2-fluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 58691893 |
| Molecular Formula | C12H16FNO3S |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | (2S)-3-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-2-fluoropropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C[C@@H](F)CN[C@@H]1CCc2ccccc21 |
| InChI | InChI=1S/C12H16FNO3S/c13-10(8-18(15,16)17)7-14-12-6-5-9-3-1-2-4-11(9)12/h1-4,10,12,14H,5-8H2,(H,15,16,17)/t10-,12+/m0/s1 |
| InChIKey | IWRNKTZJPWQNGX-CMPLNLGQSA-N |
| XLogP | 1.49 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|