C16H16IN — CID 65477774
N-[(4-iodophenyl)methyl]-2,3-dihydro-1H-inden-1-amine (PubChem CID 65477774) has the molecular formula C16H16IN and a molecular weight of 349.22 g/mol. Its IUPAC name is N-[(4-iodophenyl)methyl]-2,3-dihydro-1H-inden-1-amine.
| Compound Name | N-[(4-iodophenyl)methyl]-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 65477774 |
| Molecular Formula | C16H16IN |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | N-[(4-iodophenyl)methyl]-2,3-dihydro-1H-inden-1-amine |
| SMILES | Ic1ccc(CNC2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C16H16IN/c17-14-8-5-12(6-9-14)11-18-16-10-7-13-3-1-2-4-15(13)16/h1-6,8-9,16,18H,7,10-11H2 |
| InChIKey | PNMMMRPSBQNYAX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|