C16H13ClO2 — CID 129392555
5-[(1S,3R)-3-chloro-2,3-dihydro-1H-inden-1-yl]-1,3-benzodioxole (PubChem CID 129392555) has the molecular formula C16H13ClO2 and a molecular weight of 272.73 g/mol. Its IUPAC name is 5-[(1S,3R)-3-chloro-2,3-dihydro-1H-inden-1-yl]-1,3-benzodioxole.
| Compound Name | 5-[(1S,3R)-3-chloro-2,3-dihydro-1H-inden-1-yl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 129392555 |
| Molecular Formula | C16H13ClO2 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 5-[(1S,3R)-3-chloro-2,3-dihydro-1H-inden-1-yl]-1,3-benzodioxole |
| SMILES | Cl[C@@H]1C[C@@H](c2ccc3c(c2)OCO3)c2ccccc21 |
| InChI | InChI=1S/C16H13ClO2/c17-14-8-13(11-3-1-2-4-12(11)14)10-5-6-15-16(7-10)19-9-18-15/h1-7,13-14H,8-9H2/t13-,14+/m0/s1 |
| InChIKey | NUTPROPWGPYRSU-UONOGXRCSA-N |
| XLogP | 4.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|