About 2-(1,3-benzodioxol-5-yl)-1,3-thiazolidine;hydrochloride
2-(1,3-benzodioxol-5-yl)-1,3-thiazolidine;hydrochloride (PubChem CID 14155913) has the molecular formula C10H12ClNO2S
and a molecular weight of 245.73 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-1,3-thiazolidine;hydrochloride.
Molecular Properties
| Compound Name | 2-(1,3-benzodioxol-5-yl)-1,3-thiazolidine;hydrochloride |
| PubChem CID | 14155913 |
| Molecular Formula | C10H12ClNO2S |
| Molecular Weight | 245.73 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-1,3-thiazolidine;hydrochloride |
| SMILES | Cl.c1cc2c(cc1C1NCCS1)OCO2 |
| InChI | InChI=1S/C10H11NO2S.ClH/c1-2-8-9(13-6-12-8)5-7(1)10-11-3-4-14-10;/h1-2,5,10-11H,3-4,6H2;1H |
| InChIKey | UKJFXCRMRVMLDA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.73 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,3-benzodioxol-5-yl)-1,3-thiazolidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzodioxol-5-yl)-1,3-thiazolidine;hydrochloride?
The IUPAC name of 2-(1,3-benzodioxol-5-yl)-1,3-thiazolidine;hydrochloride (CID 14155913) is 2-(1,3-benzodioxol-5-yl)-1,3-thiazolidine;hydrochloride.
What is the SMILES notation for 2-(1,3-benzodioxol-5-yl)-1,3-thiazolidine;hydrochloride?
The canonical SMILES for 2-(1,3-benzodioxol-5-yl)-1,3-thiazolidine;hydrochloride is Cl.c1cc2c(cc1C1NCCS1)OCO2.
What is the InChIKey of 2-(1,3-benzodioxol-5-yl)-1,3-thiazolidine;hydrochloride?
The InChIKey is UKJFXCRMRVMLDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2S.ClH/c1-2-8-9(13-6-12-8)5-7(1)10-11-3-4-14-10;/h1-2,5,10-11H,3-4,6H2;1H.
What are the key properties of 2-(1,3-benzodioxol-5-yl)-1,3-thiazolidine;hydrochloride?
2-(1,3-benzodioxol-5-yl)-1,3-thiazolidine;hydrochloride has a molecular weight of 245.73 g/mol, XLogP of 2.17, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzodioxol-5-yl)-1,3-thiazolidine;hydrochloride is sourced from PubChem (CID 14155913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).