C11H13NOS — CID 129367473
(2S)-2-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazolidine (PubChem CID 129367473) has the molecular formula C11H13NOS and a molecular weight of 207.30 g/mol. Its IUPAC name is (2S)-2-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazolidine.
| Compound Name | (2S)-2-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 129367473 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | (2S)-2-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazolidine |
| SMILES | c1cc2c(cc1[C@H]1NCCS1)CCO2 |
| InChI | InChI=1S/C11H13NOS/c1-2-10-8(3-5-13-10)7-9(1)11-12-4-6-14-11/h1-2,7,11-12H,3-6H2/t11-/m0/s1 |
| InChIKey | HZBYZMGGLZTYJU-NSHDSACASA-N |
| XLogP | 1.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |