C11H15N3O — CID 76936947
5-(2,3-dihydro-1-benzofuran-5-yl)pyrazolidin-3-amine (PubChem CID 76936947) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 5-(2,3-dihydro-1-benzofuran-5-yl)pyrazolidin-3-amine.
| Compound Name | 5-(2,3-dihydro-1-benzofuran-5-yl)pyrazolidin-3-amine |
|---|---|
| PubChem CID | 76936947 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 5-(2,3-dihydro-1-benzofuran-5-yl)pyrazolidin-3-amine |
| SMILES | NC1CC(c2ccc3c(c2)CCO3)NN1 |
| InChI | InChI=1S/C11H15N3O/c12-11-6-9(13-14-11)7-1-2-10-8(5-7)3-4-15-10/h1-2,5,9,11,13-14H,3-4,6,12H2 |
| InChIKey | DLDDTUOHHBDQEI-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |