C13H18N2O3S — CID 104544340
6-(2,3-dihydro-1-benzofuran-5-yl)piperidine-3-sulfonamide (PubChem CID 104544340) has the molecular formula C13H18N2O3S and a molecular weight of 282.37 g/mol. Its IUPAC name is 6-(2,3-dihydro-1-benzofuran-5-yl)piperidine-3-sulfonamide.
| Compound Name | 6-(2,3-dihydro-1-benzofuran-5-yl)piperidine-3-sulfonamide |
|---|---|
| PubChem CID | 104544340 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 6-(2,3-dihydro-1-benzofuran-5-yl)piperidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CCC(c2ccc3c(c2)CCO3)NC1 |
| InChI | InChI=1S/C13H18N2O3S/c14-19(16,17)11-2-3-12(15-8-11)9-1-4-13-10(7-9)5-6-18-13/h1,4,7,11-12,15H,2-3,5-6,8H2,(H2,14,16,17) |
| InChIKey | REKAALKMPQBBPP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |