C12H16N2O — CID 129493232
(3R,4R)-4-(2,3-dihydro-1-benzofuran-5-yl)pyrrolidin-3-amine (PubChem CID 129493232) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is (3R,4R)-4-(2,3-dihydro-1-benzofuran-5-yl)pyrrolidin-3-amine.
| Compound Name | (3R,4R)-4-(2,3-dihydro-1-benzofuran-5-yl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 129493232 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | (3R,4R)-4-(2,3-dihydro-1-benzofuran-5-yl)pyrrolidin-3-amine |
| SMILES | N[C@H]1CNC[C@H]1c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C12H16N2O/c13-11-7-14-6-10(11)8-1-2-12-9(5-8)3-4-15-12/h1-2,5,10-11,14H,3-4,6-7,13H2/t10-,11-/m0/s1 |
| InChIKey | IGTOKZHXNPYDMC-QWRGUYRKSA-N |
| XLogP | 0.64 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |