C13H17NO2 — CID 121199351
[4-(2,3-dihydro-1-benzofuran-5-yl)pyrrolidin-3-yl]methanol (PubChem CID 121199351) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is [4-(2,3-dihydro-1-benzofuran-5-yl)pyrrolidin-3-yl]methanol.
| Compound Name | [4-(2,3-dihydro-1-benzofuran-5-yl)pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 121199351 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | [4-(2,3-dihydro-1-benzofuran-5-yl)pyrrolidin-3-yl]methanol |
| SMILES | OCC1CNCC1c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C13H17NO2/c15-8-11-6-14-7-12(11)9-1-2-13-10(5-9)3-4-16-13/h1-2,5,11-12,14-15H,3-4,6-8H2 |
| InChIKey | JPAPRZQKYMTZMQ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |