C12H14FNO2 — CID 129494013
(3R,4R)-3-(1,3-benzodioxol-5-yl)-4-(fluoromethyl)pyrrolidine (PubChem CID 129494013) has the molecular formula C12H14FNO2 and a molecular weight of 223.25 g/mol. Its IUPAC name is (3R,4R)-3-(1,3-benzodioxol-5-yl)-4-(fluoromethyl)pyrrolidine.
| Compound Name | (3R,4R)-3-(1,3-benzodioxol-5-yl)-4-(fluoromethyl)pyrrolidine |
|---|---|
| PubChem CID | 129494013 |
| Molecular Formula | C12H14FNO2 |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | (3R,4R)-3-(1,3-benzodioxol-5-yl)-4-(fluoromethyl)pyrrolidine |
| SMILES | FC[C@H]1CNC[C@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H14FNO2/c13-4-9-5-14-6-10(9)8-1-2-11-12(3-8)16-7-15-11/h1-3,9-10,14H,4-7H2/t9-,10-/m0/s1 |
| InChIKey | VILXRYMLMJLMAU-UWVGGRQHSA-N |
| XLogP | 1.69 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |