C10H13FN2 — CID 129493269
3-[(3R,4R)-4-(fluoromethyl)pyrrolidin-3-yl]pyridine (PubChem CID 129493269) has the molecular formula C10H13FN2 and a molecular weight of 180.23 g/mol. Its IUPAC name is 3-[(3R,4R)-4-(fluoromethyl)pyrrolidin-3-yl]pyridine.
| Compound Name | 3-[(3R,4R)-4-(fluoromethyl)pyrrolidin-3-yl]pyridine |
|---|---|
| PubChem CID | 129493269 |
| Molecular Formula | C10H13FN2 |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | 3-[(3R,4R)-4-(fluoromethyl)pyrrolidin-3-yl]pyridine |
| SMILES | FC[C@H]1CNC[C@H]1c1cccnc1 |
| InChI | InChI=1S/C10H13FN2/c11-4-9-6-13-7-10(9)8-2-1-3-12-5-8/h1-3,5,9-10,13H,4,6-7H2/t9-,10-/m0/s1 |
| InChIKey | JGNCDSWNPNJIBI-UWVGGRQHSA-N |
| XLogP | 1.35 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |