C16H17ClN2 — CID 79454588
3-[3-(2-chlorophenyl)piperidin-4-yl]pyridine (PubChem CID 79454588) has the molecular formula C16H17ClN2 and a molecular weight of 272.78 g/mol. Its IUPAC name is 3-[3-(2-chlorophenyl)piperidin-4-yl]pyridine.
| Compound Name | 3-[3-(2-chlorophenyl)piperidin-4-yl]pyridine |
|---|---|
| PubChem CID | 79454588 |
| Molecular Formula | C16H17ClN2 |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 3-[3-(2-chlorophenyl)piperidin-4-yl]pyridine |
| SMILES | Clc1ccccc1C1CNCCC1c1cccnc1 |
| InChI | InChI=1S/C16H17ClN2/c17-16-6-2-1-5-14(16)15-11-19-9-7-13(15)12-4-3-8-18-10-12/h1-6,8,10,13,15,19H,7,9,11H2 |
| InChIKey | RRZKYFPZIMMGSK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |