C19H19N3S — CID 166803869
2-[[(3S,4R)-4-phenylpyrrolidin-3-yl]methyl]-4-pyridin-3-yl-1,3-thiazole (PubChem CID 166803869) has the molecular formula C19H19N3S and a molecular weight of 321.45 g/mol. Its IUPAC name is 2-[[(3S,4R)-4-phenylpyrrolidin-3-yl]methyl]-4-pyridin-3-yl-1,3-thiazole.
| Compound Name | 2-[[(3S,4R)-4-phenylpyrrolidin-3-yl]methyl]-4-pyridin-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 166803869 |
| Molecular Formula | C19H19N3S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 2-[[(3S,4R)-4-phenylpyrrolidin-3-yl]methyl]-4-pyridin-3-yl-1,3-thiazole |
| SMILES | c1ccc([C@@H]2CNC[C@H]2Cc2nc(-c3cccnc3)cs2)cc1 |
| InChI | InChI=1S/C19H19N3S/c1-2-5-14(6-3-1)17-12-21-11-16(17)9-19-22-18(13-23-19)15-7-4-8-20-10-15/h1-8,10,13,16-17,21H,9,11-12H2/t16-,17+/m1/s1 |
| InChIKey | GNANGUNOJQBNMQ-SJORKVTESA-N |
| XLogP | 3.75 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |