C17H20ClNS — CID 79816966
2-[(2-chlorocycloheptyl)methyl]-4-phenyl-1,3-thiazole (PubChem CID 79816966) has the molecular formula C17H20ClNS and a molecular weight of 305.87 g/mol. Its IUPAC name is 2-[(2-chlorocycloheptyl)methyl]-4-phenyl-1,3-thiazole.
| Compound Name | 2-[(2-chlorocycloheptyl)methyl]-4-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 79816966 |
| Molecular Formula | C17H20ClNS |
| Molecular Weight | 305.87 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 2-[(2-chlorocycloheptyl)methyl]-4-phenyl-1,3-thiazole |
| SMILES | ClC1CCCCCC1Cc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C17H20ClNS/c18-15-10-6-2-5-9-14(15)11-17-19-16(12-20-17)13-7-3-1-4-8-13/h1,3-4,7-8,12,14-15H,2,5-6,9-11H2 |
| InChIKey | ASLHFKJZVBYDMT-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.87 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|